C17H19BrN4 — CID 142977055
2-bromo-N-(4,5-dihydropyrimidin-2-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-amine (PubChem CID 142977055) has the molecular formula C17H19BrN4 and a molecular weight of 359.27 g/mol. Its IUPAC name is 2-bromo-N-(4,5-dihydropyrimidin-2-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-amine.
| Compound Name | 2-bromo-N-(4,5-dihydropyrimidin-2-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-amine |
|---|---|
| PubChem CID | 142977055 |
| Molecular Formula | C17H19BrN4 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-bromo-N-(4,5-dihydropyrimidin-2-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-amine |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCCCC3NC1=NCCC=N1 |
| InChI | InChI=1S/C17H19BrN4/c18-11-6-7-14-13(10-11)12-4-1-2-5-15(16(12)21-14)22-17-19-8-3-9-20-17/h6-8,10,15,21H,1-5,9H2,(H,20,22) |
| InChIKey | NWIFGWQNAUEXGZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|