C21H30BrN3O2 — CID 155191551
3-[(2-bromo-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)amino]propyl-tert-butylcarbamic acid (PubChem CID 155191551) has the molecular formula C21H30BrN3O2 and a molecular weight of 436.39 g/mol. Its IUPAC name is 3-[(2-bromo-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)amino]propyl-tert-butylcarbamic acid.
| Compound Name | 3-[(2-bromo-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)amino]propyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 155191551 |
| Molecular Formula | C21H30BrN3O2 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 3-[(2-bromo-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)amino]propyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCCNC1CCCCc2c1[nH]c1ccc(Br)cc21)C(=O)O |
| InChI | InChI=1S/C21H30BrN3O2/c1-21(2,3)25(20(26)27)12-6-11-23-18-8-5-4-7-15-16-13-14(22)9-10-17(16)24-19(15)18/h9-10,13,18,23-24H,4-8,11-12H2,1-3H3,(H,26,27) |
| InChIKey | ITFFWTKTKZXJJS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|