C26H31BrN4O — CID 163410624
1-[4-[[4-[[[(1R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]ethanone (PubChem CID 163410624) has the molecular formula C26H31BrN4O and a molecular weight of 495.47 g/mol. Its IUPAC name is 1-[4-[[4-[[[(1R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-[[[(1R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 163410624 |
| Molecular Formula | C26H31BrN4O |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 1-[4-[[4-[[[(1R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2ccc(CN[C@@H]3CCCc4c3[nH]c3ccc(Br)cc43)cc2)CC1 |
| InChI | InChI=1S/C26H31BrN4O/c1-18(32)31-13-11-30(12-14-31)17-20-7-5-19(6-8-20)16-28-25-4-2-3-22-23-15-21(27)9-10-24(23)29-26(22)25/h5-10,15,25,28-29H,2-4,11-14,16-17H2,1H3/t25-/m1/s1 |
| InChIKey | KUYTWORQALRRAV-RUZDIDTESA-N |
| XLogP | 4.76 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|