C21H25BrN2S — CID 163706735
(1R)-6-bromo-N-[(5-tert-butylthiophen-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 163706735) has the molecular formula C21H25BrN2S and a molecular weight of 417.42 g/mol. Its IUPAC name is (1R)-6-bromo-N-[(5-tert-butylthiophen-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | (1R)-6-bromo-N-[(5-tert-butylthiophen-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 163706735 |
| Molecular Formula | C21H25BrN2S |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (1R)-6-bromo-N-[(5-tert-butylthiophen-2-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CC(C)(C)c1ccc(CN[C@@H]2CCCc3c2[nH]c2ccc(Br)cc32)s1 |
| InChI | InChI=1S/C21H25BrN2S/c1-21(2,3)19-10-8-14(25-19)12-23-18-6-4-5-15-16-11-13(22)7-9-17(16)24-20(15)18/h7-11,18,23-24H,4-6,12H2,1-3H3/t18-/m1/s1 |
| InChIKey | KFSBOWWQXSYNJJ-GOSISDBHSA-N |
| XLogP | 6.46 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|