C25H24N2 — CID 1381328
(1S)-N-benzyl-6-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 1381328) has the molecular formula C25H24N2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (1S)-N-benzyl-6-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | (1S)-N-benzyl-6-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 1381328 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (1S)-N-benzyl-6-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | c1ccc(CN[C@H]2CCCc3c2[nH]c2ccc(-c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C25H24N2/c1-3-8-18(9-4-1)17-26-24-13-7-12-21-22-16-20(19-10-5-2-6-11-19)14-15-23(22)27-25(21)24/h1-6,8-11,14-16,24,26-27H,7,12-13,17H2/t24-/m0/s1 |
| InChIKey | JGESULKOTYJLJR-DEOSSOPVSA-N |
| XLogP | 6.00 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|