C17H19N3O — CID 65333601
N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65333601) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65333601 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | Cc1cc(CNC2CCCc3c2[nH]c2ccccc32)no1 |
| InChI | InChI=1S/C17H19N3O/c1-11-9-12(20-21-11)10-18-16-8-4-6-14-13-5-2-3-7-15(13)19-17(14)16/h2-3,5,7,9,16,18-19H,4,6,8,10H2,1H3 |
| InChIKey | BPJHQKCOARSELQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|