C19H28N2 — CID 65333391
N-heptan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65333391) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-heptan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-heptan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65333391 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-heptan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CCCCCC(C)NC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C19H28N2/c1-3-4-5-9-14(2)20-18-13-8-11-16-15-10-6-7-12-17(15)21-19(16)18/h6-7,10,12,14,18,20-21H,3-5,8-9,11,13H2,1-2H3 |
| InChIKey | XCMMTVUSSLILDZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|