C17H24N2O — CID 65333809
N-(1-methoxybutan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65333809) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(1-methoxybutan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-(1-methoxybutan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65333809 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(1-methoxybutan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CCC(COC)NC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C17H24N2O/c1-3-12(11-20-2)18-16-10-6-8-14-13-7-4-5-9-15(13)19-17(14)16/h4-5,7,9,12,16,18-19H,3,6,8,10-11H2,1-2H3 |
| InChIKey | UYUBCQBRMJFUFV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|