C15H18N2O2 — CID 124604925
2-methoxy-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide (PubChem CID 124604925) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-methoxy-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide.
| Compound Name | 2-methoxy-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide |
|---|---|
| PubChem CID | 124604925 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-methoxy-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide |
| SMILES | COCC(=O)N[C@@H]1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C15H18N2O2/c1-19-9-14(18)16-13-8-4-6-11-10-5-2-3-7-12(10)17-15(11)13/h2-3,5,7,13,17H,4,6,8-9H2,1H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | IKYGNLMNXXNVKQ-CYBMUJFWSA-N |
| XLogP | 2.31 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|