C15H25NO — CID 43094167
N-heptan-2-yl-4,5,6,7-tetrahydro-1-benzofuran-4-amine (PubChem CID 43094167) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-heptan-2-yl-4,5,6,7-tetrahydro-1-benzofuran-4-amine.
| Compound Name | N-heptan-2-yl-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 43094167 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-heptan-2-yl-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
| SMILES | CCCCCC(C)NC1CCCc2occc21 |
| InChI | InChI=1S/C15H25NO/c1-3-4-5-7-12(2)16-14-8-6-9-15-13(14)10-11-17-15/h10-12,14,16H,3-9H2,1-2H3 |
| InChIKey | CGVKJFBNIYROKB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|