C18H24N2O — CID 114756055
2-[1-[(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)methyl]cyclopropyl]ethanol (PubChem CID 114756055) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[1-[(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)methyl]cyclopropyl]ethanol.
| Compound Name | 2-[1-[(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)methyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 114756055 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[1-[(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)methyl]cyclopropyl]ethanol |
| SMILES | OCCC1(CNC2CCCc3c2[nH]c2ccccc32)CC1 |
| InChI | InChI=1S/C18H24N2O/c21-11-10-18(8-9-18)12-19-16-7-3-5-14-13-4-1-2-6-15(13)20-17(14)16/h1-2,4,6,16,19-21H,3,5,7-12H2 |
| InChIKey | NIIPFGDMTZHXLN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|