C12H13NS — CID 138599371
2,3,4,9-tetrahydro-1H-carbazole-1-thiol (PubChem CID 138599371) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is 2,3,4,9-tetrahydro-1H-carbazole-1-thiol.
| Compound Name | 2,3,4,9-tetrahydro-1H-carbazole-1-thiol |
|---|---|
| PubChem CID | 138599371 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2,3,4,9-tetrahydro-1H-carbazole-1-thiol |
| SMILES | SC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C12H13NS/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-2,4,6,11,13-14H,3,5,7H2 |
| InChIKey | OAPZGHIIPOWFOS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|