C18H17N3 — CID 139602071
phenyl(2,3,4,9-tetrahydro-1H-carbazol-1-yl)diazene (PubChem CID 139602071) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is phenyl(2,3,4,9-tetrahydro-1H-carbazol-1-yl)diazene.
| Compound Name | phenyl(2,3,4,9-tetrahydro-1H-carbazol-1-yl)diazene |
|---|---|
| PubChem CID | 139602071 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | phenyl(2,3,4,9-tetrahydro-1H-carbazol-1-yl)diazene |
| SMILES | c1ccc(/N=N/C2CCCc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C18H17N3/c1-2-7-13(8-3-1)20-21-17-12-6-10-15-14-9-4-5-11-16(14)19-18(15)17/h1-5,7-9,11,17,19H,6,10,12H2/b21-20+ |
| InChIKey | WROPPFIPZSHETF-QZQOTICOSA-N |
| XLogP | 5.33 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|