C13H16N2 — CID 26342575
[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]methanamine (PubChem CID 26342575) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is [(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]methanamine.
| Compound Name | [(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]methanamine |
|---|---|
| PubChem CID | 26342575 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | [(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]methanamine |
| SMILES | NC[C@H]1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C13H16N2/c14-8-9-4-3-6-11-10-5-1-2-7-12(10)15-13(9)11/h1-2,5,7,9,15H,3-4,6,8,14H2/t9-/m1/s1 |
| InChIKey | JGTWNJYBSOLIHR-SECBINFHSA-N |
| XLogP | 2.55 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |