C13H15N — CID 10511740
3-ethyl-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 10511740) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-ethyl-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 3-ethyl-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 10511740 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-ethyl-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | CCC1CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C13H15N/c1-2-9-7-8-11-10-5-3-4-6-12(10)14-13(9)11/h3-6,9,14H,2,7-8H2,1H3 |
| InChIKey | CLECAZWYBZFTGM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |