C18H18N2 — CID 42604913
6-ethyl-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine (PubChem CID 42604913) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-ethyl-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine.
| Compound Name | 6-ethyl-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine |
|---|---|
| PubChem CID | 42604913 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-ethyl-5,6,7,12-tetrahydroindolo[2,3-c][1]benzazepine |
| SMILES | CCC1Nc2ccccc2Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C18H18N2/c1-2-15-18-14(13-8-4-6-10-17(13)20-18)11-12-7-3-5-9-16(12)19-15/h3-10,15,19-20H,2,11H2,1H3 |
| InChIKey | VODDJHZYPHLKJU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|