C14H19N3 — CID 10014060
N,N-dimethyl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methanamine (PubChem CID 10014060) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N,N-dimethyl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methanamine |
|---|---|
| PubChem CID | 10014060 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N,N-dimethyl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methanamine |
| SMILES | CN(C)CC1NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C14H19N3/c1-17(2)9-13-14-11(7-8-15-13)10-5-3-4-6-12(10)16-14/h3-6,13,15-16H,7-9H2,1-2H3 |
| InChIKey | DKGUOPNSLCYLQW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|