C23H30N4 — CID 69380213
N,N-dimethyl-3-pyridin-2-yl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pentan-3-amine (PubChem CID 69380213) has the molecular formula C23H30N4 and a molecular weight of 362.52 g/mol. Its IUPAC name is N,N-dimethyl-3-pyridin-2-yl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pentan-3-amine.
| Compound Name | N,N-dimethyl-3-pyridin-2-yl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pentan-3-amine |
|---|---|
| PubChem CID | 69380213 |
| Molecular Formula | C23H30N4 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | N,N-dimethyl-3-pyridin-2-yl-1-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)pentan-3-amine |
| SMILES | CCC(CCC1NCCc2c1[nH]c1ccccc21)(c1ccccn1)N(C)C |
| InChI | InChI=1S/C23H30N4/c1-4-23(27(2)3,21-11-7-8-15-25-21)14-12-20-22-18(13-16-24-20)17-9-5-6-10-19(17)26-22/h5-11,15,20,24,26H,4,12-14,16H2,1-3H3 |
| InChIKey | GLLDRXYMOMPUEY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|