C31H41N3O — CID 69379513
cyclohexyl-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 69379513) has the molecular formula C31H41N3O and a molecular weight of 471.69 g/mol. Its IUPAC name is cyclohexyl-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | cyclohexyl-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 69379513 |
| Molecular Formula | C31H41N3O |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | cyclohexyl-[1-[3-(dimethylamino)-3-phenylpentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | CCC(CCC1c2[nH]c3ccccc3c2CCN1C(=O)C1CCCCC1)(c1ccccc1)N(C)C |
| InChI | InChI=1S/C31H41N3O/c1-4-31(33(2)3,24-15-9-6-10-16-24)21-19-28-29-26(25-17-11-12-18-27(25)32-29)20-22-34(28)30(35)23-13-7-5-8-14-23/h6,9-12,15-18,23,28,32H,4-5,7-8,13-14,19-22H2,1-3H3 |
| InChIKey | FJOKFDJHJFPZIC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|