C33H36FN3O — CID 69380683
(E)-1-[1-[3-(dimethylamino)-3-(3-fluorophenyl)pentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 69380683) has the molecular formula C33H36FN3O and a molecular weight of 509.67 g/mol. Its IUPAC name is (E)-1-[1-[3-(dimethylamino)-3-(3-fluorophenyl)pentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[1-[3-(dimethylamino)-3-(3-fluorophenyl)pentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 69380683 |
| Molecular Formula | C33H36FN3O |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | (E)-1-[1-[3-(dimethylamino)-3-(3-fluorophenyl)pentyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | CCC(CCC1c2[nH]c3ccccc3c2CCN1C(=O)/C=C/c1ccccc1)(c1cccc(F)c1)N(C)C |
| InChI | InChI=1S/C33H36FN3O/c1-4-33(36(2)3,25-13-10-14-26(34)23-25)21-19-30-32-28(27-15-8-9-16-29(27)35-32)20-22-37(30)31(38)18-17-24-11-6-5-7-12-24/h5-18,23,30,35H,4,19-22H2,1-3H3/b18-17+ |
| InChIKey | OZMMNIBSJMXPKH-ISLYRVAYSA-N |
| XLogP | 7.09 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|