C29H22N2O4 — CID 54182010
4-[3-[1-(1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 54182010) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 4-[3-[1-(1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-[1-(1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54182010 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 4-[3-[1-(1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=CC(=O)N2CCc3c([nH]c4ccccc34)C2c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C29H22N2O4/c32-26(14-11-18-9-12-19(13-10-18)29(33)34)31-16-15-22-21-6-2-3-7-23(21)30-27(22)28(31)25-17-20-5-1-4-8-24(20)35-25/h1-14,17,28,30H,15-16H2,(H,33,34) |
| InChIKey | PCLPBIVCFNXAJQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|