C29H26N2O — CID 66994151
(E)-1-[1-(2,3-dihydro-1H-inden-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 66994151) has the molecular formula C29H26N2O and a molecular weight of 418.54 g/mol. Its IUPAC name is (E)-1-[1-(2,3-dihydro-1H-inden-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[1-(2,3-dihydro-1H-inden-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 66994151 |
| Molecular Formula | C29H26N2O |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (E)-1-[1-(2,3-dihydro-1H-inden-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C29H26N2O/c32-27(16-13-20-7-2-1-3-8-20)31-18-17-25-24-11-4-5-12-26(24)30-28(25)29(31)23-15-14-21-9-6-10-22(21)19-23/h1-5,7-8,11-16,19,29-30H,6,9-10,17-18H2/b16-13+ |
| InChIKey | HHSWYRSZCMXBDD-DTQAZKPQSA-N |
| XLogP | 5.84 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|