C29H28N4O2 — CID 90930233
1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[6-(dimethylamino)-3-pyridinyl]prop-2-en-1-one (PubChem CID 90930233) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[6-(dimethylamino)-3-pyridinyl]prop-2-en-1-one.
| Compound Name | 1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[6-(dimethylamino)-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90930233 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[6-(dimethylamino)-3-pyridinyl]prop-2-en-1-one |
| SMILES | CN(C)c1ccc(C=CC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2c2ccc3c(c2)CCO3)cn1 |
| InChI | InChI=1S/C29H28N4O2/c1-32(2)26-11-7-19(18-30-26)8-12-27(34)33-15-13-23-22-5-3-4-6-24(22)31-28(23)29(33)21-9-10-25-20(17-21)14-16-35-25/h3-12,17-18,29,31H,13-16H2,1-2H3/t29-/m1/s1 |
| InChIKey | RSSHBZVZRSNICU-GDLZYMKVSA-N |
| XLogP | 4.75 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|