C35H38N2O4 — CID 139842398
(E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 139842398) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is (E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139842398 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | (E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)N2CCc3c([nH]c4ccccc34)C2c2ccc3c(c2)OCO3)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C35H38N2O4/c1-34(2,3)25-17-21(18-26(33(25)39)35(4,5)6)11-14-30(38)37-16-15-24-23-9-7-8-10-27(23)36-31(24)32(37)22-12-13-28-29(19-22)41-20-40-28/h7-14,17-19,32,36,39H,15-16,20H2,1-6H3/b14-11+ |
| InChIKey | HVDSFUBRXJRFOS-SDNWHVSQSA-N |
| XLogP | 7.38 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|