C34H27N3O6S — CID 15887803
N-(benzenesulfonyl)-4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzamide (PubChem CID 15887803) has the molecular formula C34H27N3O6S and a molecular weight of 605.67 g/mol. Its IUPAC name is N-(benzenesulfonyl)-4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-(benzenesulfonyl)-4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 15887803 |
| Molecular Formula | C34H27N3O6S |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | N-(benzenesulfonyl)-4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1ccc(/C=C/C(=O)N2CCc3c([nH]c4ccccc34)C2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C34H27N3O6S/c38-31(17-12-22-10-13-23(14-11-22)34(39)36-44(40,41)25-6-2-1-3-7-25)37-19-18-27-26-8-4-5-9-28(26)35-32(27)33(37)24-15-16-29-30(20-24)43-21-42-29/h1-17,20,33,35H,18-19,21H2,(H,36,39)/b17-12+ |
| InChIKey | ZAAWMJWDZUQEIS-SFQUDFHCSA-N |
| XLogP | 5.20 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|