C27H21N3O6 — CID 54473920
1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-hydroxy-4-nitrophenyl)prop-2-en-1-one (PubChem CID 54473920) has the molecular formula C27H21N3O6 and a molecular weight of 483.48 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-hydroxy-4-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-hydroxy-4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54473920 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-hydroxy-4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])c(O)c1)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H21N3O6/c31-22-13-16(5-8-21(22)30(33)34)6-10-25(32)29-12-11-19-18-3-1-2-4-20(18)28-26(19)27(29)17-7-9-23-24(14-17)36-15-35-23/h1-10,13-14,27-28,31H,11-12,15H2 |
| InChIKey | XKFPCLHOLIPMLS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|