C32H30N4O5 — CID 54382491
1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitro-2-piperidin-1-ylphenyl)prop-2-en-1-one (PubChem CID 54382491) has the molecular formula C32H30N4O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitro-2-piperidin-1-ylphenyl)prop-2-en-1-one.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitro-2-piperidin-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54382491 |
| Molecular Formula | C32H30N4O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitro-2-piperidin-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1N1CCCCC1)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H30N4O5/c37-29(14-12-21-7-6-10-26(36(38)39)31(21)34-16-4-1-5-17-34)35-18-15-24-23-8-2-3-9-25(23)33-30(24)32(35)22-11-13-27-28(19-22)41-20-40-27/h2-3,6-14,19,32-33H,1,4-5,15-18,20H2 |
| InChIKey | VAXCUYQJWUHJGN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|