C28H22ClN3O4 — CID 18800032
(E)-3-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one (PubChem CID 18800032) has the molecular formula C28H22ClN3O4 and a molecular weight of 499.95 g/mol. Its IUPAC name is (E)-3-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18800032 |
| Molecular Formula | C28H22ClN3O4 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | (E)-3-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc([N+](=O)[O-])ccc1Cl)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C28H22ClN3O4/c29-23-8-7-20(32(34)35)16-17(23)6-10-26(33)31-13-11-22-21-3-1-2-4-24(21)30-27(22)28(31)19-5-9-25-18(15-19)12-14-36-25/h1-10,15-16,28,30H,11-14H2/b10-6+ |
| InChIKey | JCDXQVDQGPZOMP-UXBLZVDNSA-N |
| XLogP | 5.85 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|