C26H22N2O3 — CID 91531260
1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(furan-3-yl)prop-2-en-1-one (PubChem CID 91531260) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(furan-3-yl)prop-2-en-1-one.
| Compound Name | 1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(furan-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91531260 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(furan-3-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccoc1)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C26H22N2O3/c29-24(8-5-17-10-13-30-16-17)28-12-9-21-20-3-1-2-4-22(20)27-25(21)26(28)19-6-7-23-18(15-19)11-14-31-23/h1-8,10,13,15-16,26-27H,9,11-12,14H2/t26-/m1/s1 |
| InChIKey | FRXFEFYEFUYDDP-AREMUKBSSA-N |
| XLogP | 4.88 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|