C28H22N2O5 — CID 54497479
3-[3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 54497479) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is 3-[3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 3-[3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54497479 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 3-[3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C=CC(=O)N2CCc3c([nH]c4ccccc34)C2c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C28H22N2O5/c31-25(11-8-17-4-3-5-19(14-17)28(32)33)30-13-12-21-20-6-1-2-7-22(20)29-26(21)27(30)18-9-10-23-24(15-18)35-16-34-23/h1-11,14-15,27,29H,12-13,16H2,(H,32,33) |
| InChIKey | YADGZKKHGLXMIG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|