C31H31N3O4 — CID 66994045
(E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[2-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one (PubChem CID 66994045) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is (E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[2-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[2-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 66994045 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (E)-1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-[2-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one |
| SMILES | CN(C)CCOc1ccccc1/C=C/C(=O)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H31N3O4/c1-33(2)17-18-36-26-10-6-3-7-21(26)12-14-29(35)34-16-15-24-23-8-4-5-9-25(23)32-30(24)31(34)22-11-13-27-28(19-22)38-20-37-27/h3-14,19,31-32H,15-18,20H2,1-2H3/b14-12+ |
| InChIKey | NFLRESQMKDGKJI-WYMLVPIESA-N |
| XLogP | 5.02 |
| TPSA | 67.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|