C26H22N2O3 — CID 7651201
[(1S)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methylphenyl)methanone (PubChem CID 7651201) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is [(1S)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methylphenyl)methanone.
| Compound Name | [(1S)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 7651201 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(1S)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCc3c([nH]c4ccccc34)[C@@H]2c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C26H22N2O3/c1-16-5-4-6-18(13-16)26(29)28-12-11-20-19-7-2-3-8-21(19)27-24(20)25(28)17-9-10-22-23(14-17)31-15-30-22/h2-10,13-14,25,27H,11-12,15H2,1H3/t25-/m0/s1 |
| InChIKey | WANKUNIVBYEGLK-VWLOTQADSA-N |
| XLogP | 4.99 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|