C23H23N3O4 — CID 143445401
N-[2-[(1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-N-methylacetamide (PubChem CID 143445401) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[2-[(1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-N-methylacetamide.
| Compound Name | N-[2-[(1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 143445401 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[2-[(1R)-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H23N3O4/c1-14(27)25(2)12-21(28)26-10-9-17-16-5-3-4-6-18(16)24-22(17)23(26)15-7-8-19-20(11-15)30-13-29-19/h3-8,11,23-24H,9-10,12-13H2,1-2H3/t23-/m1/s1 |
| InChIKey | CWMJJDNXYTXVEM-HSZRJFAPSA-N |
| XLogP | 2.85 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|