C29H24FN3O4 — CID 22252175
N-[4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]phenyl]acetamide (PubChem CID 22252175) has the molecular formula C29H24FN3O4 and a molecular weight of 497.53 g/mol. Its IUPAC name is N-[4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22252175 |
| Molecular Formula | C29H24FN3O4 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)N2CCc3c([nH]c4ccc(F)cc34)C2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C29H24FN3O4/c1-17(34)31-21-7-2-18(3-8-21)4-11-27(35)33-13-12-22-23-15-20(30)6-9-24(23)32-28(22)29(33)19-5-10-25-26(14-19)37-16-36-25/h2-11,14-15,29,32H,12-13,16H2,1H3,(H,31,34)/b11-4+ |
| InChIKey | VBMICAVPBYCOLC-NYYWCZLTSA-N |
| XLogP | 5.18 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|