C27H24N2O — CID 46227700
(E)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 46227700) has the molecular formula C27H24N2O and a molecular weight of 392.50 g/mol. Its IUPAC name is (E)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 46227700 |
| Molecular Formula | C27H24N2O |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (E)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N2O/c1-19-11-14-21(15-12-19)27-26-23(22-9-5-6-10-24(22)28-26)17-18-29(27)25(30)16-13-20-7-3-2-4-8-20/h2-16,27-28H,17-18H2,1H3/b16-13+ |
| InChIKey | XWSYIQQRVPOFPA-DTQAZKPQSA-N |
| XLogP | 5.66 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|