C26H24N2O2 — CID 92730422
1-[(1S)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenoxyethanone (PubChem CID 92730422) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[(1S)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenoxyethanone.
| Compound Name | 1-[(1S)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 92730422 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(1S)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenoxyethanone |
| SMILES | Cc1ccc([C@H]2c3[nH]c4ccccc4c3CCN2C(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-18-11-13-19(14-12-18)26-25-22(21-9-5-6-10-23(21)27-25)15-16-28(26)24(29)17-30-20-7-3-2-4-8-20/h2-14,26-27H,15-17H2,1H3/t26-/m0/s1 |
| InChIKey | LGDIERPZJFBNFC-SANMLTNESA-N |
| XLogP | 5.03 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|