C24H21N3O2 — CID 92730511
2-phenoxy-1-[(1R)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 92730511) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-phenoxy-1-[(1R)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 2-phenoxy-1-[(1R)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 92730511 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-phenoxy-1-[(1R)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | O=C(COc1ccccc1)N1CCc2c([nH]c3ccccc23)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C24H21N3O2/c28-22(16-29-18-8-2-1-3-9-18)27-14-12-20-19-10-4-5-11-21(19)26-23(20)24(27)17-7-6-13-25-15-17/h1-11,13,15,24,26H,12,14,16H2/t24-/m1/s1 |
| InChIKey | TXMOHBLTJZBTKA-XMMPIXPASA-N |
| XLogP | 4.12 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|