C23H18ClN3O — CID 42383850
[(1R)-1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone (PubChem CID 42383850) has the molecular formula C23H18ClN3O and a molecular weight of 387.87 g/mol. Its IUPAC name is [(1R)-1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [(1R)-1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 42383850 |
| Molecular Formula | C23H18ClN3O |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(1R)-1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCc2c([nH]c3ccccc23)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18ClN3O/c24-17-7-3-5-15(13-17)22-21-19(18-8-1-2-9-20(18)26-21)10-12-27(22)23(28)16-6-4-11-25-14-16/h1-9,11,13-14,22,26H,10,12H2/t22-/m1/s1 |
| InChIKey | CJEYGRYMNXUKPC-JOCHJYFZSA-N |
| XLogP | 5.00 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|