C24H17Cl3N2O — CID 7037538
[(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,4-dichlorophenyl)methanone (PubChem CID 7037538) has the molecular formula C24H17Cl3N2O and a molecular weight of 455.77 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 7037538 |
| Molecular Formula | C24H17Cl3N2O |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(2,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17Cl3N2O/c25-15-7-5-14(6-8-15)23-22-18(17-3-1-2-4-21(17)28-22)11-12-29(23)24(30)19-10-9-16(26)13-20(19)27/h1-10,13,23,28H,11-12H2/t23-/m0/s1 |
| InChIKey | RQTGQDIJVBESLZ-QHCPKHFHSA-N |
| XLogP | 6.92 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|