C22H21ClN2O — CID 46359958
[1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-cyclobutylmethanone (PubChem CID 46359958) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-cyclobutylmethanone.
| Compound Name | [1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 46359958 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CCc2c([nH]c3ccccc23)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O/c23-16-10-8-14(9-11-16)21-20-18(17-6-1-2-7-19(17)24-20)12-13-25(21)22(26)15-4-3-5-15/h1-2,6-11,15,21,24H,3-5,12-13H2 |
| InChIKey | PSPDDXKQDRCSPS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|