C19H19ClN2O — CID 122367996
2-[(1R)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol (PubChem CID 122367996) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-[(1R)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol.
| Compound Name | 2-[(1R)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol |
|---|---|
| PubChem CID | 122367996 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(1R)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol |
| SMILES | OCCN1CCc2c([nH]c3ccccc23)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O/c20-14-7-5-13(6-8-14)19-18-16(9-10-22(19)11-12-23)15-3-1-2-4-17(15)21-18/h1-8,19,21,23H,9-12H2/t19-/m1/s1 |
| InChIKey | KJENGQHGPDRMLH-LJQANCHMSA-N |
| XLogP | 3.76 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|