C22H22F4N2O — CID 25460567
(1S)-1-(4-fluoro-3-methoxyphenyl)-2-(4,4,4-trifluorobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 25460567) has the molecular formula C22H22F4N2O and a molecular weight of 406.42 g/mol. Its IUPAC name is (1S)-1-(4-fluoro-3-methoxyphenyl)-2-(4,4,4-trifluorobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-1-(4-fluoro-3-methoxyphenyl)-2-(4,4,4-trifluorobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 25460567 |
| Molecular Formula | C22H22F4N2O |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (1S)-1-(4-fluoro-3-methoxyphenyl)-2-(4,4,4-trifluorobutyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1cc([C@H]2c3[nH]c4ccccc4c3CCN2CCCC(F)(F)F)ccc1F |
| InChI | InChI=1S/C22H22F4N2O/c1-29-19-13-14(7-8-17(19)23)21-20-16(15-5-2-3-6-18(15)27-20)9-12-28(21)11-4-10-22(24,25)26/h2-3,5-8,13,21,27H,4,9-12H2,1H3/t21-/m0/s1 |
| InChIKey | OAILDNZPTHODSG-NRFANRHFSA-N |
| XLogP | 5.61 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|