C23H28N2O2 — CID 10451427
2-butyl-1-(3,4-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 10451427) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-butyl-1-(3,4-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-butyl-1-(3,4-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 10451427 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-butyl-1-(3,4-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCN1CCc2c([nH]c3ccccc23)C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O2/c1-4-5-13-25-14-12-18-17-8-6-7-9-19(17)24-22(18)23(25)16-10-11-20(26-2)21(15-16)27-3/h6-11,15,23-24H,4-5,12-14H2,1-3H3 |
| InChIKey | DPXJBTQVKINBHR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|