C23H26N2O4 — CID 146036448
(1S,3S)-2-butyl-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 146036448) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (1S,3S)-2-butyl-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1S,3S)-2-butyl-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 146036448 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (1S,3S)-2-butyl-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CCCCN1[C@@H](c2ccc(O)c(OC)c2)c2[nH]c3ccccc3c2C[C@H]1C(=O)O |
| InChI | InChI=1S/C23H26N2O4/c1-3-4-11-25-18(23(27)28)13-16-15-7-5-6-8-17(15)24-21(16)22(25)14-9-10-19(26)20(12-14)29-2/h5-10,12,18,22,24,26H,3-4,11,13H2,1-2H3,(H,27,28)/t18-,22-/m0/s1 |
| InChIKey | GTEAKDUMPOPKQI-AVRDEDQJSA-N |
| XLogP | 4.08 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|