C26H27ClN2O5 — CID 71951066
methyl 2-(2-chloroacetyl)-1-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 71951066) has the molecular formula C26H27ClN2O5 and a molecular weight of 482.96 g/mol. Its IUPAC name is methyl 2-(2-chloroacetyl)-1-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 2-(2-chloroacetyl)-1-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 71951066 |
| Molecular Formula | C26H27ClN2O5 |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl 2-(2-chloroacetyl)-1-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | C=C(C)COc1ccc(C2c3[nH]c4ccccc4c3CC(C(=O)OC)N2C(=O)CCl)cc1OC |
| InChI | InChI=1S/C26H27ClN2O5/c1-15(2)14-34-21-10-9-16(11-22(21)32-3)25-24-18(17-7-5-6-8-19(17)28-24)12-20(26(31)33-4)29(25)23(30)13-27/h5-11,20,25,28H,1,12-14H2,2-4H3 |
| InChIKey | CETJGBPMPWHGCW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|