C22H21ClN2O4 — CID 42108598
methyl (1R,3S)-2-(2-chloroacetyl)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 42108598) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is methyl (1R,3S)-2-(2-chloroacetyl)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3S)-2-(2-chloroacetyl)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 42108598 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl (1R,3S)-2-(2-chloroacetyl)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccccc2OC)N1C(=O)CCl |
| InChI | InChI=1S/C22H21ClN2O4/c1-28-18-10-6-4-8-14(18)21-20-15(13-7-3-5-9-16(13)24-20)11-17(22(27)29-2)25(21)19(26)12-23/h3-10,17,21,24H,11-12H2,1-2H3/t17-,21+/m0/s1 |
| InChIKey | KQXMMSCTNRYOON-LAUBAEHRSA-N |
| XLogP | 3.43 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|