C25H23ClN2O7 — CID 59087893
methyl (1R,3R)-2-(2-chloroacetyl)-1-(3,4-diacetyloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 59087893) has the molecular formula C25H23ClN2O7 and a molecular weight of 498.92 g/mol. Its IUPAC name is methyl (1R,3R)-2-(2-chloroacetyl)-1-(3,4-diacetyloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3R)-2-(2-chloroacetyl)-1-(3,4-diacetyloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 59087893 |
| Molecular Formula | C25H23ClN2O7 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | methyl (1R,3R)-2-(2-chloroacetyl)-1-(3,4-diacetyloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OC(C)=O)c(OC(C)=O)c2)N1C(=O)CCl |
| InChI | InChI=1S/C25H23ClN2O7/c1-13(29)34-20-9-8-15(10-21(20)35-14(2)30)24-23-17(16-6-4-5-7-18(16)27-23)11-19(25(32)33-3)28(24)22(31)12-26/h4-10,19,24,27H,11-12H2,1-3H3/t19-,24-/m1/s1 |
| InChIKey | MPWXCILKDDIZFS-NTKDMRAZSA-N |
| XLogP | 3.27 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|