C18H17ClN4O3 — CID 25153595
methyl (3S)-2-(2-chloroacetyl)-1-(1H-imidazol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 25153595) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is methyl (3S)-2-(2-chloroacetyl)-1-(1H-imidazol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (3S)-2-(2-chloroacetyl)-1-(1H-imidazol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 25153595 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | methyl (3S)-2-(2-chloroacetyl)-1-(1H-imidazol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)C(c2cnc[nH]2)N1C(=O)CCl |
| InChI | InChI=1S/C18H17ClN4O3/c1-26-18(25)14-6-11-10-4-2-3-5-12(10)22-16(11)17(13-8-20-9-21-13)23(14)15(24)7-19/h2-5,8-9,14,17,22H,6-7H2,1H3,(H,20,21)/t14-,17?/m0/s1 |
| InChIKey | VOEUQVGKUWGDIZ-MBIQTGHCSA-N |
| XLogP | 2.15 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|