C29H32N2O4 — CID 6346045
(2R)-1-[(1R,3S)-1-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenoxypropan-2-ol (PubChem CID 6346045) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is (2R)-1-[(1R,3S)-1-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[(1R,3S)-1-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 6346045 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (2R)-1-[(1R,3S)-1-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenoxypropan-2-ol |
| SMILES | COc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@H](C)N2C[C@@H](O)COc2ccccc2)cc1OC |
| InChI | InChI=1S/C29H32N2O4/c1-19-15-24-23-11-7-8-12-25(23)30-28(24)29(20-13-14-26(33-2)27(16-20)34-3)31(19)17-21(32)18-35-22-9-5-4-6-10-22/h4-14,16,19,21,29-30,32H,15,17-18H2,1-3H3/t19-,21+,29+/m0/s1 |
| InChIKey | DDIKBTWEGPODRH-XPXNCJDLSA-N |
| XLogP | 4.96 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|