C30H29N3O5 — CID 3662327
2-(3,4-dimethoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 3662327) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 3662327 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-[(4-methoxyphenyl)methyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc(CN2CC(=O)N3C(Cc4c([nH]c5ccccc45)C3c3ccc(OC)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H29N3O5/c1-36-20-11-8-18(9-12-20)16-32-17-27(34)33-24(30(32)35)15-22-21-6-4-5-7-23(21)31-28(22)29(33)19-10-13-25(37-2)26(14-19)38-3/h4-14,24,29,31H,15-17H2,1-3H3 |
| InChIKey | CPIWPXMYTHCBAU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|